C20H25NO5 — CID 69408195
(3S,4S,5R)-1-(dibenzylamino)-3,4,5,6-tetrahydroxyhexan-2-one (PubChem CID 69408195) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is (3S,4S,5R)-1-(dibenzylamino)-3,4,5,6-tetrahydroxyhexan-2-one.
| Compound Name | (3S,4S,5R)-1-(dibenzylamino)-3,4,5,6-tetrahydroxyhexan-2-one |
|---|---|
| PubChem CID | 69408195 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3S,4S,5R)-1-(dibenzylamino)-3,4,5,6-tetrahydroxyhexan-2-one |
| SMILES | O=C(CN(Cc1ccccc1)Cc1ccccc1)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C20H25NO5/c22-14-18(24)20(26)19(25)17(23)13-21(11-15-7-3-1-4-8-15)12-16-9-5-2-6-10-16/h1-10,18-20,22,24-26H,11-14H2/t18-,19-,20+/m1/s1 |
| InChIKey | UBEAYAXTJWERHS-AQNXPRMDSA-N |
| XLogP | 0.33 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |