C22H20N2O3 — CID 69408236
ethyl 2,2-bis[(4-cyanophenyl)methyl]-3-oxobutanoate (PubChem CID 69408236) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl 2,2-bis[(4-cyanophenyl)methyl]-3-oxobutanoate.
| Compound Name | ethyl 2,2-bis[(4-cyanophenyl)methyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 69408236 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | ethyl 2,2-bis[(4-cyanophenyl)methyl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(Cc1ccc(C#N)cc1)(Cc1ccc(C#N)cc1)C(C)=O |
| InChI | InChI=1S/C22H20N2O3/c1-3-27-21(26)22(16(2)25,12-17-4-8-19(14-23)9-5-17)13-18-6-10-20(15-24)11-7-18/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | SKKQYMLTIBOQCV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|