About acetonitrile;1,3-dimethylimidazolidin-2-one
acetonitrile;1,3-dimethylimidazolidin-2-one (PubChem CID 69408679) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is acetonitrile;1,3-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | acetonitrile;1,3-dimethylimidazolidin-2-one |
| PubChem CID | 69408679 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | acetonitrile;1,3-dimethylimidazolidin-2-one |
| SMILES | CC#N.CN1CCN(C)C1=O |
| InChI | InChI=1S/C5H10N2O.C2H3N/c1-6-3-4-7(2)5(6)8;1-2-3/h3-4H2,1-2H3;1H3 |
| InChIKey | FFHBJVLMORPLIS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;1,3-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;1,3-dimethylimidazolidin-2-one?
The IUPAC name of acetonitrile;1,3-dimethylimidazolidin-2-one (CID 69408679) is acetonitrile;1,3-dimethylimidazolidin-2-one.
What is the SMILES notation for acetonitrile;1,3-dimethylimidazolidin-2-one?
The canonical SMILES for acetonitrile;1,3-dimethylimidazolidin-2-one is CC#N.CN1CCN(C)C1=O.
What is the InChIKey of acetonitrile;1,3-dimethylimidazolidin-2-one?
The InChIKey is FFHBJVLMORPLIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O.C2H3N/c1-6-3-4-7(2)5(6)8;1-2-3/h3-4H2,1-2H3;1H3.
What are the key properties of acetonitrile;1,3-dimethylimidazolidin-2-one?
acetonitrile;1,3-dimethylimidazolidin-2-one has a molecular weight of 155.20 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;1,3-dimethylimidazolidin-2-one is sourced from PubChem (CID 69408679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).