About 1,3-dihydrobenzimidazole-2-thione;propanoic acid
1,3-dihydrobenzimidazole-2-thione;propanoic acid (PubChem CID 69408724) has the molecular formula C10H12N2O2S
and a molecular weight of 224.28 g/mol. Its IUPAC name is 1,3-dihydrobenzimidazole-2-thione;propanoic acid.
Molecular Properties
| Compound Name | 1,3-dihydrobenzimidazole-2-thione;propanoic acid |
| PubChem CID | 69408724 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 1,3-dihydrobenzimidazole-2-thione;propanoic acid |
| SMILES | CCC(=O)O.S=c1[nH]c2ccccc2[nH]1 |
| InChI | InChI=1S/C7H6N2S.C3H6O2/c10-7-8-5-3-1-2-4-6(5)9-7;1-2-3(4)5/h1-4H,(H2,8,9,10);2H2,1H3,(H,4,5) |
| InChIKey | KTTIXWAVJOVNLF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydrobenzimidazole-2-thione;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydrobenzimidazole-2-thione;propanoic acid?
The IUPAC name of 1,3-dihydrobenzimidazole-2-thione;propanoic acid (CID 69408724) is 1,3-dihydrobenzimidazole-2-thione;propanoic acid.
What is the SMILES notation for 1,3-dihydrobenzimidazole-2-thione;propanoic acid?
The canonical SMILES for 1,3-dihydrobenzimidazole-2-thione;propanoic acid is CCC(=O)O.S=c1[nH]c2ccccc2[nH]1.
What is the InChIKey of 1,3-dihydrobenzimidazole-2-thione;propanoic acid?
The InChIKey is KTTIXWAVJOVNLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2S.C3H6O2/c10-7-8-5-3-1-2-4-6(5)9-7;1-2-3(4)5/h1-4H,(H2,8,9,10);2H2,1H3,(H,4,5).
What are the key properties of 1,3-dihydrobenzimidazole-2-thione;propanoic acid?
1,3-dihydrobenzimidazole-2-thione;propanoic acid has a molecular weight of 224.28 g/mol, XLogP of 2.71, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydrobenzimidazole-2-thione;propanoic acid is sourced from PubChem (CID 69408724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).