C13H23N5O — CID 69409128
1-(4-methylpiperazin-1-yl)-2-(2,4,4-triaminocyclohexa-1,5-dien-1-yl)ethanone (PubChem CID 69409128) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)-2-(2,4,4-triaminocyclohexa-1,5-dien-1-yl)ethanone.
| Compound Name | 1-(4-methylpiperazin-1-yl)-2-(2,4,4-triaminocyclohexa-1,5-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 69409128 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)-2-(2,4,4-triaminocyclohexa-1,5-dien-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CC2=C(N)CC(N)(N)C=C2)CC1 |
| InChI | InChI=1S/C13H23N5O/c1-17-4-6-18(7-5-17)12(19)8-10-2-3-13(15,16)9-11(10)14/h2-3H,4-9,14-16H2,1H3 |
| InChIKey | OFSNQQNPVMMBFH-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|