C30H34N6O — CID 69409148
1-[4-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)phenyl]-1,2-dimethylguanidine (PubChem CID 69409148) has the molecular formula C30H34N6O and a molecular weight of 494.64 g/mol. Its IUPAC name is 1-[4-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)phenyl]-1,2-dimethylguanidine.
| Compound Name | 1-[4-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)phenyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 69409148 |
| Molecular Formula | C30H34N6O |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 1-[4-(3-benzyl-5-cyclohexyl-2-oxo-1,3,4-benzotriazepin-1-yl)phenyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\N)N(C)c1ccc(N2C(=O)N(Cc3ccccc3)N=C(C3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H34N6O/c1-32-29(31)34(2)24-17-19-25(20-18-24)36-27-16-10-9-15-26(27)28(23-13-7-4-8-14-23)33-35(30(36)37)21-22-11-5-3-6-12-22/h3,5-6,9-12,15-20,23H,4,7-8,13-14,21H2,1-2H3,(H2,31,32) |
| InChIKey | ISHVKAGSVKWWIU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|