C17H18S2 — CID 694094
7,8-dimethyl-3-phenyl-1,5-dihydro-2,4-benzodithiepine (PubChem CID 694094) has the molecular formula C17H18S2 and a molecular weight of 286.47 g/mol. Its IUPAC name is 7,8-dimethyl-3-phenyl-1,5-dihydro-2,4-benzodithiepine.
| Compound Name | 7,8-dimethyl-3-phenyl-1,5-dihydro-2,4-benzodithiepine |
|---|---|
| PubChem CID | 694094 |
| Molecular Formula | C17H18S2 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 7,8-dimethyl-3-phenyl-1,5-dihydro-2,4-benzodithiepine |
| SMILES | Cc1cc2c(cc1C)CSC(c1ccccc1)SC2 |
| InChI | InChI=1S/C17H18S2/c1-12-8-15-10-18-17(14-6-4-3-5-7-14)19-11-16(15)9-13(12)2/h3-9,17H,10-11H2,1-2H3 |
| InChIKey | HQRAPJHAYXQOFB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |