About 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate
1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate (PubChem CID 69409477) has the molecular formula C21H23FN2O4
and a molecular weight of 386.42 g/mol. Its IUPAC name is 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate.
Molecular Properties
| Compound Name | 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate |
| PubChem CID | 69409477 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate |
| SMILES | COC(=O)/C(=C(/C)NCc1ccccc1)[C@H](N)C(=O)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN2O4/c1-14(24-12-15-6-4-3-5-7-15)18(20(25)27-2)19(23)21(26)28-13-16-8-10-17(22)11-9-16/h3-11,19,24H,12-13,23H2,1-2H3/b18-14-/t19-/m0/s1 |
| InChIKey | CUFLKTXUEQANCB-BSKAQADGSA-N |
| XLogP | 2.43 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate?
The IUPAC name of 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate (CID 69409477) is 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate.
What is the SMILES notation for 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate?
The canonical SMILES for 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate is COC(=O)/C(=C(/C)NCc1ccccc1)[C@H](N)C(=O)OCc1ccc(F)cc1.
What is the InChIKey of 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate?
The InChIKey is CUFLKTXUEQANCB-BSKAQADGSA-N. The full InChI is InChI=1S/C21H23FN2O4/c1-14(24-12-15-6-4-3-5-7-15)18(20(25)27-2)19(23)21(26)28-13-16-8-10-17(22)11-9-16/h3-11,19,24H,12-13,23H2,1-2H3/b18-14-/t19-/m0/s1.
What are the key properties of 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate?
1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate has a molecular weight of 386.42 g/mol, XLogP of 2.43, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[(4-fluorophenyl)methyl] 4-O-methyl (2S,3Z)-2-amino-3-[1-(benzylamino)ethylidene]butanedioate is sourced from PubChem (CID 69409477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).