About 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane
2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane (PubChem CID 69409606) has the molecular formula C12H16OSi
and a molecular weight of 204.34 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane |
| PubChem CID | 69409606 |
| Molecular Formula | C12H16OSi |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane |
| SMILES | C=C[Si](C)(C=C)OC1=CC2C=CC1C2 |
| InChI | InChI=1S/C12H16OSi/c1-4-14(3,5-2)13-12-9-10-6-7-11(12)8-10/h4-7,9-11H,1-2,8H2,3H3 |
| InChIKey | YLNSQGPYXQLMDA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane?
The IUPAC name of 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane (CID 69409606) is 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane.
What is the SMILES notation for 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane?
The canonical SMILES for 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane is C=C[Si](C)(C=C)OC1=CC2C=CC1C2.
What is the InChIKey of 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane?
The InChIKey is YLNSQGPYXQLMDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OSi/c1-4-14(3,5-2)13-12-9-10-6-7-11(12)8-10/h4-7,9-11H,1-2,8H2,3H3.
What are the key properties of 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane?
2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane has a molecular weight of 204.34 g/mol, XLogP of 3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]hepta-2,5-dienyloxy-bis(ethenyl)-methylsilane is sourced from PubChem (CID 69409606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).