C22H21N9O5S — CID 69409828
1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-1-(4-morpholin-4-ylsulfonylphenyl)urea (PubChem CID 69409828) has the molecular formula C22H21N9O5S and a molecular weight of 523.54 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-1-(4-morpholin-4-ylsulfonylphenyl)urea.
| Compound Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-1-(4-morpholin-4-ylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 69409828 |
| Molecular Formula | C22H21N9O5S |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 1-[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-1-(4-morpholin-4-ylsulfonylphenyl)urea |
| SMILES | Cn1cc2c(nc(N(C(N)=O)c3ccc(S(=O)(=O)N4CCOCC4)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C22H21N9O5S/c1-28-13-16-18(26-28)25-22(31-20(16)24-19(27-31)17-3-2-10-36-17)30(21(23)32)14-4-6-15(7-5-14)37(33,34)29-8-11-35-12-9-29/h2-7,10,13H,8-9,11-12H2,1H3,(H2,23,32) |
| InChIKey | WPNQKVPEXSKLJN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 166.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |