C15H10BrIO — CID 69410946
5-bromo-12-iodotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (PubChem CID 69410946) has the molecular formula C15H10BrIO and a molecular weight of 413.05 g/mol. Its IUPAC name is 5-bromo-12-iodotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one.
| Compound Name | 5-bromo-12-iodotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
|---|---|
| PubChem CID | 69410946 |
| Molecular Formula | C15H10BrIO |
| Molecular Weight | 413.05 g/mol |
| Exact Mass | 411.90 |
| IUPAC Name | 5-bromo-12-iodotricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| SMILES | O=C1c2cc(Br)ccc2CCc2c(I)cccc21 |
| InChI | InChI=1S/C15H10BrIO/c16-10-6-4-9-5-7-11-12(2-1-3-14(11)17)15(18)13(9)8-10/h1-4,6,8H,5,7H2 |
| InChIKey | OUEDAPDARZIDPK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.05 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|