About dimethyl-penta-1,4-dienyl-phenylsilane
dimethyl-penta-1,4-dienyl-phenylsilane (PubChem CID 69411193) has the molecular formula C13H18Si
and a molecular weight of 202.37 g/mol. Its IUPAC name is dimethyl-penta-1,4-dienyl-phenylsilane.
Molecular Properties
| Compound Name | dimethyl-penta-1,4-dienyl-phenylsilane |
| PubChem CID | 69411193 |
| Molecular Formula | C13H18Si |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | dimethyl-penta-1,4-dienyl-phenylsilane |
| SMILES | C=CCC=C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C13H18Si/c1-4-5-9-12-14(2,3)13-10-7-6-8-11-13/h4,6-12H,1,5H2,2-3H3 |
| InChIKey | JISGEWKWRWIHTN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-penta-1,4-dienyl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-penta-1,4-dienyl-phenylsilane?
The IUPAC name of dimethyl-penta-1,4-dienyl-phenylsilane (CID 69411193) is dimethyl-penta-1,4-dienyl-phenylsilane.
What is the SMILES notation for dimethyl-penta-1,4-dienyl-phenylsilane?
The canonical SMILES for dimethyl-penta-1,4-dienyl-phenylsilane is C=CCC=C[Si](C)(C)c1ccccc1.
What is the InChIKey of dimethyl-penta-1,4-dienyl-phenylsilane?
The InChIKey is JISGEWKWRWIHTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Si/c1-4-5-9-12-14(2,3)13-10-7-6-8-11-13/h4,6-12H,1,5H2,2-3H3.
What are the key properties of dimethyl-penta-1,4-dienyl-phenylsilane?
dimethyl-penta-1,4-dienyl-phenylsilane has a molecular weight of 202.37 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-penta-1,4-dienyl-phenylsilane is sourced from PubChem (CID 69411193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).