C8H12O4 — CID 69411223
1-ethoxycyclohexa-3,5-diene-1,2,4-triol (PubChem CID 69411223) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 1-ethoxycyclohexa-3,5-diene-1,2,4-triol.
| Compound Name | 1-ethoxycyclohexa-3,5-diene-1,2,4-triol |
|---|---|
| PubChem CID | 69411223 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1-ethoxycyclohexa-3,5-diene-1,2,4-triol |
| SMILES | CCOC1(O)C=CC(O)=CC1O |
| InChI | InChI=1S/C8H12O4/c1-2-12-8(11)4-3-6(9)5-7(8)10/h3-5,7,9-11H,2H2,1H3 |
| InChIKey | PJUAFVQUDROXBK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|