C29H24ClN5O3 — CID 69411499
8-[(2-chlorobenzoyl)amino]-1-[4-[3-(methylamino)-3-oxoprop-1-enyl]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 69411499) has the molecular formula C29H24ClN5O3 and a molecular weight of 526.00 g/mol. Its IUPAC name is 8-[(2-chlorobenzoyl)amino]-1-[4-[3-(methylamino)-3-oxoprop-1-enyl]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-[(2-chlorobenzoyl)amino]-1-[4-[3-(methylamino)-3-oxoprop-1-enyl]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 69411499 |
| Molecular Formula | C29H24ClN5O3 |
| Molecular Weight | 526.00 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 8-[(2-chlorobenzoyl)amino]-1-[4-[3-(methylamino)-3-oxoprop-1-enyl]phenyl]-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | CNC(=O)C=Cc1ccc(-n2nc(C(N)=O)c3c2-c2cc(NC(=O)c4ccccc4Cl)ccc2CC3)cc1 |
| InChI | InChI=1S/C29H24ClN5O3/c1-32-25(36)15-8-17-6-12-20(13-7-17)35-27-22(26(34-35)28(31)37)14-10-18-9-11-19(16-23(18)27)33-29(38)21-4-2-3-5-24(21)30/h2-9,11-13,15-16H,10,14H2,1H3,(H2,31,37)(H,32,36)(H,33,38) |
| InChIKey | ZIBBFDTXDSHPEG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.00 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|