C28H44O9 — CID 69411546
(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7-diacetyloxy-3,7,12-trihydroxy-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 69411546) has the molecular formula C28H44O9 and a molecular weight of 524.65 g/mol. Its IUPAC name is (4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7-diacetyloxy-3,7,12-trihydroxy-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7-diacetyloxy-3,7,12-trihydroxy-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 69411546 |
| Molecular Formula | C28H44O9 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | (4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7-diacetyloxy-3,7,12-trihydroxy-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | CC(=O)O[C@]1(O)CC[C@@]2(C)[C@@H](C1)C[C@@](O)(OC(C)=O)[C@@H]1[C@@H]2C[C@H](O)[C@]2(C)[C@@H]([C@H](C)CCC(=O)O)CC[C@@H]12 |
| InChI | InChI=1S/C28H44O9/c1-15(6-9-23(32)33)19-7-8-20-24-21(12-22(31)26(19,20)5)25(4)10-11-27(34,36-16(2)29)13-18(25)14-28(24,35)37-17(3)30/h15,18-22,24,31,34-35H,6-14H2,1-5H3,(H,32,33)/t15-,18+,19-,20+,21+,22+,24+,25+,26-,27-,28-/m1/s1 |
| InChIKey | FAMZBEZLORZCMO-XJAXEFNCSA-N |
| XLogP | 3.23 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|