About 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate
4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate (PubChem CID 69411574) has the molecular formula C24H35NO5
and a molecular weight of 417.55 g/mol. Its IUPAC name is 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate.
Molecular Properties
| Compound Name | 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate |
| PubChem CID | 69411574 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate |
| SMILES | CCC1(CC)CC(OC(=O)C=CC(=O)OC)CC(C)(C)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C24H35NO5/c1-7-24(8-2)17-20(29-22(27)15-14-21(26)28-6)16-23(4,5)25(24)30-18(3)19-12-10-9-11-13-19/h9-15,18,20H,7-8,16-17H2,1-6H3 |
| InChIKey | RYCDTWNUONSAKI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate?
The IUPAC name of 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate (CID 69411574) is 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate.
What is the SMILES notation for 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate?
The canonical SMILES for 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate is CCC1(CC)CC(OC(=O)C=CC(=O)OC)CC(C)(C)N1OC(C)c1ccccc1.
What is the InChIKey of 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate?
The InChIKey is RYCDTWNUONSAKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H35NO5/c1-7-24(8-2)17-20(29-22(27)15-14-21(26)28-6)16-23(4,5)25(24)30-18(3)19-12-10-9-11-13-19/h9-15,18,20H,7-8,16-17H2,1-6H3.
What are the key properties of 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate?
4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate has a molecular weight of 417.55 g/mol, XLogP of 4.75, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl] 1-O-methyl but-2-enedioate is sourced from PubChem (CID 69411574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).