C18H27NO7 — CID 69411790
(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[[4-(4-hydroxypiperidin-1-yl)phenyl]methyl]oxane-2,3,4,5-tetrol (PubChem CID 69411790) has the molecular formula C18H27NO7 and a molecular weight of 369.41 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[[4-(4-hydroxypiperidin-1-yl)phenyl]methyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[[4-(4-hydroxypiperidin-1-yl)phenyl]methyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 69411790 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-[[4-(4-hydroxypiperidin-1-yl)phenyl]methyl]oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1O[C@@H](O)[C@@](O)(Cc2ccc(N3CCC(O)CC3)cc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H27NO7/c20-10-14-15(22)16(23)18(25,17(24)26-14)9-11-1-3-12(4-2-11)19-7-5-13(21)6-8-19/h1-4,13-17,20-25H,5-10H2/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | JKLOMCWQBNZNOM-UYTYNIKBSA-N |
| XLogP | -1.65 |
| TPSA | 133.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|