About 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine
6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine (PubChem CID 69411832) has the molecular formula C18H10F3N3
and a molecular weight of 325.29 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine |
| PubChem CID | 69411832 |
| Molecular Formula | C18H10F3N3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine |
| SMILES | Fc1ccc(-c2cn3cc(-c4cc(F)cc(F)c4)cnc3n2)cc1 |
| InChI | InChI=1S/C18H10F3N3/c19-14-3-1-11(2-4-14)17-10-24-9-13(8-22-18(24)23-17)12-5-15(20)7-16(21)6-12/h1-10H |
| InChIKey | YOTIRWXNVKNACW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine?
The IUPAC name of 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine (CID 69411832) is 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine.
What is the SMILES notation for 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine?
The canonical SMILES for 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine is Fc1ccc(-c2cn3cc(-c4cc(F)cc(F)c4)cnc3n2)cc1.
What is the InChIKey of 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine?
The InChIKey is YOTIRWXNVKNACW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10F3N3/c19-14-3-1-11(2-4-14)17-10-24-9-13(8-22-18(24)23-17)12-5-15(20)7-16(21)6-12/h1-10H.
What are the key properties of 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine?
6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine has a molecular weight of 325.29 g/mol, XLogP of 4.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-difluorophenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyrimidine is sourced from PubChem (CID 69411832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).