C24H20Cl2IN3O — CID 69411847
2,3-bis(4-chlorophenyl)-N,N-diethyl-8-iodoimidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 69411847) has the molecular formula C24H20Cl2IN3O and a molecular weight of 564.25 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenyl)-N,N-diethyl-8-iodoimidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | 2,3-bis(4-chlorophenyl)-N,N-diethyl-8-iodoimidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 69411847 |
| Molecular Formula | C24H20Cl2IN3O |
| Molecular Weight | 564.25 g/mol |
| Exact Mass | 563.00 |
| IUPAC Name | 2,3-bis(4-chlorophenyl)-N,N-diethyl-8-iodoimidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(I)c2nc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)n2c1 |
| InChI | InChI=1S/C24H20Cl2IN3O/c1-3-29(4-2)24(31)17-13-20(27)23-28-21(15-5-9-18(25)10-6-15)22(30(23)14-17)16-7-11-19(26)12-8-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | JZGWJJZGVXEUNL-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.25 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|