About 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane
2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane (PubChem CID 69411849) has the molecular formula C12H18OSi
and a molecular weight of 206.36 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane |
| PubChem CID | 69411849 |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane |
| SMILES | C=C[Si](C)(C)OCC1=CC2C=CC1C2 |
| InChI | InChI=1S/C12H18OSi/c1-4-14(2,3)13-9-12-8-10-5-6-11(12)7-10/h4-6,8,10-11H,1,7,9H2,2-3H3 |
| InChIKey | HESCMUOWLSLSOR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane?
The IUPAC name of 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane (CID 69411849) is 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane.
What is the SMILES notation for 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane?
The canonical SMILES for 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane is C=C[Si](C)(C)OCC1=CC2C=CC1C2.
What is the InChIKey of 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane?
The InChIKey is HESCMUOWLSLSOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18OSi/c1-4-14(2,3)13-9-12-8-10-5-6-11(12)7-10/h4-6,8,10-11H,1,7,9H2,2-3H3.
What are the key properties of 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane?
2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane has a molecular weight of 206.36 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]hepta-2,5-dienylmethoxy-ethenyl-dimethylsilane is sourced from PubChem (CID 69411849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).