C33H40ClF2N3O5 — CID 69412258
5-chloro-1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-phenylpropan-2-ylamino)butan-2-yl]-3-N,3-N-bis(2-methoxyethyl)benzene-1,3-dicarboxamide (PubChem CID 69412258) has the molecular formula C33H40ClF2N3O5 and a molecular weight of 632.15 g/mol. Its IUPAC name is 5-chloro-1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-phenylpropan-2-ylamino)butan-2-yl]-3-N,3-N-bis(2-methoxyethyl)benzene-1,3-dicarboxamide.
| Compound Name | 5-chloro-1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-phenylpropan-2-ylamino)butan-2-yl]-3-N,3-N-bis(2-methoxyethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 69412258 |
| Molecular Formula | C33H40ClF2N3O5 |
| Molecular Weight | 632.15 g/mol |
| Exact Mass | 631.26 |
| IUPAC Name | 5-chloro-1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-(2-phenylpropan-2-ylamino)butan-2-yl]-3-N,3-N-bis(2-methoxyethyl)benzene-1,3-dicarboxamide |
| SMILES | COCCN(CCOC)C(=O)c1cc(Cl)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNC(C)(C)c2ccccc2)c1 |
| InChI | InChI=1S/C33H40ClF2N3O5/c1-33(2,25-8-6-5-7-9-25)37-21-30(40)29(16-22-14-27(35)20-28(36)15-22)38-31(41)23-17-24(19-26(34)18-23)32(42)39(10-12-43-3)11-13-44-4/h5-9,14-15,17-20,29-30,37,40H,10-13,16,21H2,1-4H3,(H,38,41)/t29-,30+/m0/s1 |
| InChIKey | SGIHNPUCEMZDMF-XZWHSSHBSA-N |
| XLogP | 4.58 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.15 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |