C24H50N4 — CID 69412540
1,1-bis(1,2,2,3-tetramethylpiperidin-4-yl)hexane-1,6-diamine (PubChem CID 69412540) has the molecular formula C24H50N4 and a molecular weight of 394.69 g/mol. Its IUPAC name is 1,1-bis(1,2,2,3-tetramethylpiperidin-4-yl)hexane-1,6-diamine.
| Compound Name | 1,1-bis(1,2,2,3-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 69412540 |
| Molecular Formula | C24H50N4 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.40 |
| IUPAC Name | 1,1-bis(1,2,2,3-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
| SMILES | CC1C(C(N)(CCCCCN)C2CCN(C)C(C)(C)C2C)CCN(C)C1(C)C |
| InChI | InChI=1S/C24H50N4/c1-18-20(12-16-27(7)22(18,3)4)24(26,14-10-9-11-15-25)21-13-17-28(8)23(5,6)19(21)2/h18-21H,9-17,25-26H2,1-8H3 |
| InChIKey | XFVCHSIUXQFXGS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|