C19H20BrN3O2 — CID 69412648
1-(3-bromophenyl)-N-tert-butyl-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxamide (PubChem CID 69412648) has the molecular formula C19H20BrN3O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-tert-butyl-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-tert-butyl-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 69412648 |
| Molecular Formula | C19H20BrN3O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 1-(3-bromophenyl)-N-tert-butyl-2-oxo-3,4-dihydro-1,8-naphthyridine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1Cc2cccnc2N(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C19H20BrN3O2/c1-19(2,3)22-17(24)15-10-12-6-5-9-21-16(12)23(18(15)25)14-8-4-7-13(20)11-14/h4-9,11,15H,10H2,1-3H3,(H,22,24) |
| InChIKey | UJNHBUQMHDCEPP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|