About 5H-1,4-dioxepine-5-carboxamide
5H-1,4-dioxepine-5-carboxamide (PubChem CID 69413368) has the molecular formula C6H7NO3
and a molecular weight of 141.13 g/mol. Its IUPAC name is 5H-1,4-dioxepine-5-carboxamide.
Molecular Properties
| Compound Name | 5H-1,4-dioxepine-5-carboxamide |
| PubChem CID | 69413368 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 5H-1,4-dioxepine-5-carboxamide |
| SMILES | NC(=O)C1C=COC=CO1 |
| InChI | InChI=1S/C6H7NO3/c7-6(8)5-1-2-9-3-4-10-5/h1-5H,(H2,7,8) |
| InChIKey | LEWZZAGWGRWVBZ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-1,4-dioxepine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-1,4-dioxepine-5-carboxamide?
The IUPAC name of 5H-1,4-dioxepine-5-carboxamide (CID 69413368) is 5H-1,4-dioxepine-5-carboxamide.
What is the SMILES notation for 5H-1,4-dioxepine-5-carboxamide?
The canonical SMILES for 5H-1,4-dioxepine-5-carboxamide is NC(=O)C1C=COC=CO1.
What is the InChIKey of 5H-1,4-dioxepine-5-carboxamide?
The InChIKey is LEWZZAGWGRWVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3/c7-6(8)5-1-2-9-3-4-10-5/h1-5H,(H2,7,8).
What are the key properties of 5H-1,4-dioxepine-5-carboxamide?
5H-1,4-dioxepine-5-carboxamide has a molecular weight of 141.13 g/mol, XLogP of -0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-1,4-dioxepine-5-carboxamide is sourced from PubChem (CID 69413368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).