C33H23ClN8O2 — CID 69413395
1-[5-(3-chlorophenyl)-1,3-oxazol-2-yl]-1,2-bis(1H-indazol-6-yl)-2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]hydrazine (PubChem CID 69413395) has the molecular formula C33H23ClN8O2 and a molecular weight of 599.05 g/mol. Its IUPAC name is 1-[5-(3-chlorophenyl)-1,3-oxazol-2-yl]-1,2-bis(1H-indazol-6-yl)-2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]hydrazine.
| Compound Name | 1-[5-(3-chlorophenyl)-1,3-oxazol-2-yl]-1,2-bis(1H-indazol-6-yl)-2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 69413395 |
| Molecular Formula | C33H23ClN8O2 |
| Molecular Weight | 599.05 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | 1-[5-(3-chlorophenyl)-1,3-oxazol-2-yl]-1,2-bis(1H-indazol-6-yl)-2-[5-(4-methylphenyl)-1,3-oxazol-2-yl]hydrazine |
| SMILES | Cc1ccc(-c2cnc(N(c3ccc4cn[nH]c4c3)N(c3ccc4cn[nH]c4c3)c3ncc(-c4cccc(Cl)c4)o3)o2)cc1 |
| InChI | InChI=1S/C33H23ClN8O2/c1-20-5-7-21(8-6-20)30-18-35-32(43-30)41(26-11-9-23-16-37-39-28(23)14-26)42(27-12-10-24-17-38-40-29(24)15-27)33-36-19-31(44-33)22-3-2-4-25(34)13-22/h2-19H,1H3,(H,37,39)(H,38,40) |
| InChIKey | FDZMVOWLKHKMTO-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.05 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|