C24H38N2O4 — CID 69413435
4-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]imino-4-methoxybutanoic acid (PubChem CID 69413435) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is 4-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]imino-4-methoxybutanoic acid.
| Compound Name | 4-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]imino-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 69413435 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 4-[2,2-diethyl-6,6-dimethyl-1-(1-phenylethoxy)piperidin-4-yl]imino-4-methoxybutanoic acid |
| SMILES | CCC1(CC)CC(/N=C(/CCC(=O)O)OC)CC(C)(C)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C24H38N2O4/c1-7-24(8-2)17-20(25-21(29-6)14-15-22(27)28)16-23(4,5)26(24)30-18(3)19-12-10-9-11-13-19/h9-13,18,20H,7-8,14-17H2,1-6H3,(H,27,28)/b25-21- |
| InChIKey | ISKDATATLBPWPK-DAFNUICNSA-N |
| XLogP | 5.39 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|