C30H33F2N3O3 — CID 69413459
3-[1-[3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-[4-(1H-indol-3-yl)piperidin-1-yl]propanoic acid (PubChem CID 69413459) has the molecular formula C30H33F2N3O3 and a molecular weight of 521.61 g/mol. Its IUPAC name is 3-[1-[3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-[4-(1H-indol-3-yl)piperidin-1-yl]propanoic acid.
| Compound Name | 3-[1-[3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-[4-(1H-indol-3-yl)piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 69413459 |
| Molecular Formula | C30H33F2N3O3 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 3-[1-[3-(3,5-difluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-[4-(1H-indol-3-yl)piperidin-1-yl]propanoic acid |
| SMILES | O=C(O)C(CC1CCN(C(=O)C=Cc2cc(F)cc(F)c2)CC1)N1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C30H33F2N3O3/c31-23-15-21(16-24(32)18-23)5-6-29(36)35-11-7-20(8-12-35)17-28(30(37)38)34-13-9-22(10-14-34)26-19-33-27-4-2-1-3-25(26)27/h1-6,15-16,18-20,22,28,33H,7-14,17H2,(H,37,38) |
| InChIKey | CGTSICXEDRNARS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|