C31H43F2N5O3 — CID 69413656
(3R)-1-butyl-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[(1-hydroxycyclohexyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 69413656) has the molecular formula C31H43F2N5O3 and a molecular weight of 571.71 g/mol. Its IUPAC name is (3R)-1-butyl-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[(1-hydroxycyclohexyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | (3R)-1-butyl-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[(1-hydroxycyclohexyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 69413656 |
| Molecular Formula | C31H43F2N5O3 |
| Molecular Weight | 571.71 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | (3R)-1-butyl-9-[[1-(2,4-difluorophenyl)-3,5-dimethylpyrazol-4-yl]methyl]-3-[(1-hydroxycyclohexyl)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCCN1C(=O)[C@@H](CC2(O)CCCCC2)NC(=O)C12CCN(Cc1c(C)nn(-c3ccc(F)cc3F)c1C)CC2 |
| InChI | InChI=1S/C31H43F2N5O3/c1-4-5-15-37-28(39)26(19-30(41)11-7-6-8-12-30)34-29(40)31(37)13-16-36(17-14-31)20-24-21(2)35-38(22(24)3)27-10-9-23(32)18-25(27)33/h9-10,18,26,41H,4-8,11-17,19-20H2,1-3H3,(H,34,40)/t26-/m1/s1 |
| InChIKey | HKOCBDBPKCHPTA-AREMUKBSSA-N |
| XLogP | 4.31 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |