C25H20F4N4O2 — CID 69413942
3-(5-benzyl-1,2,4-oxadiazol-3-yl)-1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-1,6-naphthyridin-4-one (PubChem CID 69413942) has the molecular formula C25H20F4N4O2 and a molecular weight of 484.45 g/mol. Its IUPAC name is 3-(5-benzyl-1,2,4-oxadiazol-3-yl)-1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-1,6-naphthyridin-4-one.
| Compound Name | 3-(5-benzyl-1,2,4-oxadiazol-3-yl)-1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 69413942 |
| Molecular Formula | C25H20F4N4O2 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 3-(5-benzyl-1,2,4-oxadiazol-3-yl)-1-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-5,6,7,8-tetrahydro-1,6-naphthyridin-4-one |
| SMILES | O=c1c(-c2noc(Cc3ccccc3)n2)cn(Cc2ccc(C(F)(F)F)cc2F)c2c1CNCC2 |
| InChI | InChI=1S/C25H20F4N4O2/c26-20-11-17(25(27,28)29)7-6-16(20)13-33-14-19(23(34)18-12-30-9-8-21(18)33)24-31-22(35-32-24)10-15-4-2-1-3-5-15/h1-7,11,14,30H,8-10,12-13H2 |
| InChIKey | QYVMXNXMCBRJCZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |