C27H40N2O4 — CID 69413999
N-[3-(2-methoxypentyl)-6-(4-phenylmethoxybutoxy)-2-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 69413999) has the molecular formula C27H40N2O4 and a molecular weight of 456.63 g/mol. Its IUPAC name is N-[3-(2-methoxypentyl)-6-(4-phenylmethoxybutoxy)-2-pyridinyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-(2-methoxypentyl)-6-(4-phenylmethoxybutoxy)-2-pyridinyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 69413999 |
| Molecular Formula | C27H40N2O4 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | N-[3-(2-methoxypentyl)-6-(4-phenylmethoxybutoxy)-2-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | CCCC(Cc1ccc(OCCCCOCc2ccccc2)nc1NC(=O)C(C)(C)C)OC |
| InChI | InChI=1S/C27H40N2O4/c1-6-12-23(31-5)19-22-15-16-24(28-25(22)29-26(30)27(2,3)4)33-18-11-10-17-32-20-21-13-8-7-9-14-21/h7-9,13-16,23H,6,10-12,17-20H2,1-5H3,(H,28,29,30) |
| InChIKey | BTXMFIBVYCSLFI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|