C32H36F3N3O3 — CID 69414102
ethyl 2-[4-(1H-indol-3-yl)piperidin-1-yl]-3-[1-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]propanoate (PubChem CID 69414102) has the molecular formula C32H36F3N3O3 and a molecular weight of 567.65 g/mol. Its IUPAC name is ethyl 2-[4-(1H-indol-3-yl)piperidin-1-yl]-3-[1-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]propanoate.
| Compound Name | ethyl 2-[4-(1H-indol-3-yl)piperidin-1-yl]-3-[1-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]propanoate |
|---|---|
| PubChem CID | 69414102 |
| Molecular Formula | C32H36F3N3O3 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | ethyl 2-[4-(1H-indol-3-yl)piperidin-1-yl]-3-[1-[3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]propanoate |
| SMILES | CCOC(=O)C(CC1CCN(C(=O)C=Cc2cc(F)c(F)c(F)c2)CC1)N1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C32H36F3N3O3/c1-2-41-32(40)29(37-15-11-23(12-16-37)25-20-36-28-6-4-3-5-24(25)28)19-21-9-13-38(14-10-21)30(39)8-7-22-17-26(33)31(35)27(34)18-22/h3-8,17-18,20-21,23,29,36H,2,9-16,19H2,1H3 |
| InChIKey | NGQXVMBOWZJLLL-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|