About 2-tert-butyl-3,5-dimethylbenzenethiol
2-tert-butyl-3,5-dimethylbenzenethiol (PubChem CID 69414331) has the molecular formula C12H18S
and a molecular weight of 194.34 g/mol. Its IUPAC name is 2-tert-butyl-3,5-dimethylbenzenethiol.
Molecular Properties
| Compound Name | 2-tert-butyl-3,5-dimethylbenzenethiol |
| PubChem CID | 69414331 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-tert-butyl-3,5-dimethylbenzenethiol |
| SMILES | Cc1cc(C)c(C(C)(C)C)c(S)c1 |
| InChI | InChI=1S/C12H18S/c1-8-6-9(2)11(10(13)7-8)12(3,4)5/h6-7,13H,1-5H3 |
| InChIKey | WBHISIBHVXQORD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-3,5-dimethylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3,5-dimethylbenzenethiol?
The IUPAC name of 2-tert-butyl-3,5-dimethylbenzenethiol (CID 69414331) is 2-tert-butyl-3,5-dimethylbenzenethiol.
What is the SMILES notation for 2-tert-butyl-3,5-dimethylbenzenethiol?
The canonical SMILES for 2-tert-butyl-3,5-dimethylbenzenethiol is Cc1cc(C)c(C(C)(C)C)c(S)c1.
What is the InChIKey of 2-tert-butyl-3,5-dimethylbenzenethiol?
The InChIKey is WBHISIBHVXQORD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18S/c1-8-6-9(2)11(10(13)7-8)12(3,4)5/h6-7,13H,1-5H3.
What are the key properties of 2-tert-butyl-3,5-dimethylbenzenethiol?
2-tert-butyl-3,5-dimethylbenzenethiol has a molecular weight of 194.34 g/mol, XLogP of 3.89, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3,5-dimethylbenzenethiol is sourced from PubChem (CID 69414331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).