C23H35N3O5 — CID 69414883
tert-butyl (2S)-3-[amino-[(4-methoxyphenyl)methyl]amino]-2-[(cyclohexanecarbonylamino)methyl]-3-oxopropanoate (PubChem CID 69414883) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl (2S)-3-[amino-[(4-methoxyphenyl)methyl]amino]-2-[(cyclohexanecarbonylamino)methyl]-3-oxopropanoate.
| Compound Name | tert-butyl (2S)-3-[amino-[(4-methoxyphenyl)methyl]amino]-2-[(cyclohexanecarbonylamino)methyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 69414883 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | tert-butyl (2S)-3-[amino-[(4-methoxyphenyl)methyl]amino]-2-[(cyclohexanecarbonylamino)methyl]-3-oxopropanoate |
| SMILES | COc1ccc(CN(N)C(=O)[C@H](CNC(=O)C2CCCCC2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H35N3O5/c1-23(2,3)31-22(29)19(14-25-20(27)17-8-6-5-7-9-17)21(28)26(24)15-16-10-12-18(30-4)13-11-16/h10-13,17,19H,5-9,14-15,24H2,1-4H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | VVDPBMUMRSUHDN-IBGZPJMESA-N |
| XLogP | 2.55 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|