C42H35Cl3N2O3 — CID 69414973
2,4-dibenzyl-3-[2-[2-chloro-4-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]phenyl]ethenyl]benzamide (PubChem CID 69414973) has the molecular formula C42H35Cl3N2O3 and a molecular weight of 722.11 g/mol. Its IUPAC name is 2,4-dibenzyl-3-[2-[2-chloro-4-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]phenyl]ethenyl]benzamide.
| Compound Name | 2,4-dibenzyl-3-[2-[2-chloro-4-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 69414973 |
| Molecular Formula | C42H35Cl3N2O3 |
| Molecular Weight | 722.11 g/mol |
| Exact Mass | 720.17 |
| IUPAC Name | 2,4-dibenzyl-3-[2-[2-chloro-4-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]phenyl]ethenyl]benzamide |
| SMILES | CC(C)c1onc(-c2c(Cl)cccc2Cl)c1COc1ccc(C=Cc2c(Cc3ccccc3)ccc(C(N)=O)c2Cc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C42H35Cl3N2O3/c1-26(2)41-35(40(47-50-41)39-36(43)14-9-15-37(39)44)25-49-31-19-16-29(38(45)24-31)17-20-32-30(22-27-10-5-3-6-11-27)18-21-33(42(46)48)34(32)23-28-12-7-4-8-13-28/h3-21,24,26H,22-23,25H2,1-2H3,(H2,46,48) |
| InChIKey | BIQNTQDJHHIPGQ-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.11 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|