About 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid
4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid (PubChem CID 69415800) has the molecular formula C7H14N2O4S
and a molecular weight of 222.27 g/mol. Its IUPAC name is 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid.
Molecular Properties
| Compound Name | 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid |
| PubChem CID | 69415800 |
| Molecular Formula | C7H14N2O4S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid |
| SMILES | CC1(N)C=CC(N)=CC1.O=S(=O)(O)O |
| InChI | InChI=1S/C7H12N2.H2O4S/c1-7(9)4-2-6(8)3-5-7;1-5(2,3)4/h2-4H,5,8-9H2,1H3;(H2,1,2,3,4) |
| InChIKey | QISFOZFBRWGNCP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid?
The IUPAC name of 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid (CID 69415800) is 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid.
What is the SMILES notation for 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid?
The canonical SMILES for 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid is CC1(N)C=CC(N)=CC1.O=S(=O)(O)O.
What is the InChIKey of 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid?
The InChIKey is QISFOZFBRWGNCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.H2O4S/c1-7(9)4-2-6(8)3-5-7;1-5(2,3)4/h2-4H,5,8-9H2,1H3;(H2,1,2,3,4).
What are the key properties of 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid?
4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid has a molecular weight of 222.27 g/mol, XLogP of -0.15, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid is sourced from PubChem (CID 69415800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).