4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid

C7H14N2O4S — CID 69415800

IUPAC4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid
SMILESCC1(N)C=CC(N)=CC1.O=S(=O)(O)O
InChIInChI=1S/C7H12N2.H2O4S/c1-7(9)4-2-6(8)3-5-7;1-5(2,3)4/h2-4H,5,8-9H2,1H3;(H2,1,2,3,4)
InChIKeyQISFOZFBRWGNCP-UHFFFAOYSA-N
MW222.27 g/mol
LogP-0.15
Rot. Bonds

About 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid

4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid (PubChem CID 69415800) has the molecular formula C7H14N2O4S and a molecular weight of 222.27 g/mol. Its IUPAC name is 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid.

Molecular Properties

Compound Name4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid
PubChem CID69415800
Molecular FormulaC7H14N2O4S
Molecular Weight222.27 g/mol
Exact Mass222.07
IUPAC Name4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid
SMILESCC1(N)C=CC(N)=CC1.O=S(=O)(O)O
InChIInChI=1S/C7H12N2.H2O4S/c1-7(9)4-2-6(8)3-5-7;1-5(2,3)4/h2-4H,5,8-9H2,1H3;(H2,1,2,3,4)
InChIKeyQISFOZFBRWGNCP-UHFFFAOYSA-N
XLogP-0.15
TPSA126.64 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.27
LogP ≤ 5-0.15
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid?
The IUPAC name of 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid (CID 69415800) is 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid.
What is the SMILES notation for 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid?
The canonical SMILES for 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid is CC1(N)C=CC(N)=CC1.O=S(=O)(O)O.
What is the InChIKey of 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid?
The InChIKey is QISFOZFBRWGNCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.H2O4S/c1-7(9)4-2-6(8)3-5-7;1-5(2,3)4/h2-4H,5,8-9H2,1H3;(H2,1,2,3,4).
What are the key properties of 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid?
4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid has a molecular weight of 222.27 g/mol, XLogP of -0.15, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylcyclohexa-1,5-diene-1,4-diamine;sulfuric acid is sourced from PubChem (CID 69415800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).