C12H15N — CID 69415911
2,3,4,4a,5,6-hexahydro-1H-cyclopenta[f]quinoline (PubChem CID 69415911) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2,3,4,4a,5,6-hexahydro-1H-cyclopenta[f]quinoline.
| Compound Name | 2,3,4,4a,5,6-hexahydro-1H-cyclopenta[f]quinoline |
|---|---|
| PubChem CID | 69415911 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2,3,4,4a,5,6-hexahydro-1H-cyclopenta[f]quinoline |
| SMILES | C1=CC2=C3CCCNC3CCC2=C1 |
| InChI | InChI=1S/C12H15N/c1-3-9-6-7-12-11(10(9)4-1)5-2-8-13-12/h1,3-4,12-13H,2,5-8H2 |
| InChIKey | WASSQBYVOCORIL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |