About (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride
(2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride (PubChem CID 69416529) has the molecular formula C9H19Cl2NO2
and a molecular weight of 244.16 g/mol. Its IUPAC name is (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride |
| PubChem CID | 69416529 |
| Molecular Formula | C9H19Cl2NO2 |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride |
| SMILES | COC[C@@H]1C[C@@H](OC)CN1CCCl.Cl |
| InChI | InChI=1S/C9H18ClNO2.ClH/c1-12-7-8-5-9(13-2)6-11(8)4-3-10;/h8-9H,3-7H2,1-2H3;1H/t8-,9+;/m0./s1 |
| InChIKey | BUTFYVBVKJQVRO-OULXEKPRSA-N |
| XLogP | 1.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride?
The IUPAC name of (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride (CID 69416529) is (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride.
What is the SMILES notation for (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride?
The canonical SMILES for (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride is COC[C@@H]1C[C@@H](OC)CN1CCCl.Cl.
What is the InChIKey of (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride?
The InChIKey is BUTFYVBVKJQVRO-OULXEKPRSA-N. The full InChI is InChI=1S/C9H18ClNO2.ClH/c1-12-7-8-5-9(13-2)6-11(8)4-3-10;/h8-9H,3-7H2,1-2H3;1H/t8-,9+;/m0./s1.
What are the key properties of (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride?
(2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride has a molecular weight of 244.16 g/mol, XLogP of 1.38, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-1-(2-chloroethyl)-4-methoxy-2-(methoxymethyl)pyrrolidine;hydrochloride is sourced from PubChem (CID 69416529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).