About 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol
5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol (PubChem CID 69416602) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol.
Molecular Properties
| Compound Name | 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol |
| PubChem CID | 69416602 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol |
| SMILES | CC1=CCCC2CC(C=CC=C1)OC2O |
| InChI | InChI=1S/C13H18O2/c1-10-5-2-3-8-12-9-11(7-4-6-10)13(14)15-12/h2-3,5-6,8,11-14H,4,7,9H2,1H3 |
| InChIKey | ZFQYPRNIIYZREO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol?
The IUPAC name of 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol (CID 69416602) is 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol.
What is the SMILES notation for 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol?
The canonical SMILES for 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol is CC1=CCCC2CC(C=CC=C1)OC2O.
What is the InChIKey of 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol?
The InChIKey is ZFQYPRNIIYZREO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-10-5-2-3-8-12-9-11(7-4-6-10)13(14)15-12/h2-3,5-6,8,11-14H,4,7,9H2,1H3.
What are the key properties of 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol?
5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol has a molecular weight of 206.28 g/mol, XLogP of 2.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-11-oxabicyclo[8.2.1]trideca-4,6,8-trien-12-ol is sourced from PubChem (CID 69416602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).