C17H15Cl4NO8 — CID 69416711
[(2R,3S,4R,5R,6R)-3,4-dihydroxy-6-methoxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate (PubChem CID 69416711) has the molecular formula C17H15Cl4NO8 and a molecular weight of 503.12 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4-dihydroxy-6-methoxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4-dihydroxy-6-methoxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 69416711 |
| Molecular Formula | C17H15Cl4NO8 |
| Molecular Weight | 503.12 g/mol |
| Exact Mass | 500.96 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4-dihydroxy-6-methoxy-5-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)oxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]1N1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C17H15Cl4NO8/c1-4(23)29-3-5-13(24)14(25)12(17(28-2)30-5)22-15(26)6-7(16(22)27)9(19)11(21)10(20)8(6)18/h5,12-14,17,24-25H,3H2,1-2H3/t5-,12-,13-,14-,17-/m1/s1 |
| InChIKey | LHIJOEZLAHCLKD-UIVWLQAWSA-N |
| XLogP | 1.92 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.12 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|