C28H31N3NaO8S2 — CID 69416718
CID 69416718 (PubChem CID 69416718) has the molecular formula C28H31N3NaO8S2 and a molecular weight of 624.69 g/mol.
| Compound Name | CID 69416718 |
|---|---|
| PubChem CID | 69416718 |
| Molecular Formula | C28H31N3NaO8S2 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | — |
| SMILES | COc1ccc2[nH]c(S(=O)Cc3ncc(C)c(OC)c3C)nc2c1S(=O)(=O)c1ccc(OCC(C)(C)C(=O)O)cc1.[Na] |
| InChI | InChI=1S/C28H31N3O8S2.Na/c1-16-13-29-21(17(2)24(16)38-6)14-40(34)27-30-20-11-12-22(37-5)25(23(20)31-27)41(35,36)19-9-7-18(8-10-19)39-15-28(3,4)26(32)33;/h7-13H,14-15H2,1-6H3,(H,30,31)(H,32,33); |
| InChIKey | GQEPKGGGGLJOBC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |