C22H19NO4 — CID 69417219
(E)-3-[5,6-bis(4-methoxyphenyl)-2-pyridinyl]prop-2-enoic acid (PubChem CID 69417219) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is (E)-3-[5,6-bis(4-methoxyphenyl)-2-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5,6-bis(4-methoxyphenyl)-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69417219 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (E)-3-[5,6-bis(4-methoxyphenyl)-2-pyridinyl]prop-2-enoic acid |
| SMILES | COc1ccc(-c2ccc(/C=C/C(=O)O)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H19NO4/c1-26-18-9-3-15(4-10-18)20-13-7-17(8-14-21(24)25)23-22(20)16-5-11-19(27-2)12-6-16/h3-14H,1-2H3,(H,24,25)/b14-8+ |
| InChIKey | DDCQCYWLZSVPGZ-RIYZIHGNSA-N |
| XLogP | 4.53 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|