C33H38N6O2 — CID 69417615
[2,2-dimethyl-1-[3-[2-[[4-[(2S)-7-phenyl-1,2,3,4-tetrahydro-1,6-naphthyridin-2-yl]pyrimidin-2-yl]amino]propyl]phenyl]propyl] carbamate (PubChem CID 69417615) has the molecular formula C33H38N6O2 and a molecular weight of 550.71 g/mol. Its IUPAC name is [2,2-dimethyl-1-[3-[2-[[4-[(2S)-7-phenyl-1,2,3,4-tetrahydro-1,6-naphthyridin-2-yl]pyrimidin-2-yl]amino]propyl]phenyl]propyl] carbamate.
| Compound Name | [2,2-dimethyl-1-[3-[2-[[4-[(2S)-7-phenyl-1,2,3,4-tetrahydro-1,6-naphthyridin-2-yl]pyrimidin-2-yl]amino]propyl]phenyl]propyl] carbamate |
|---|---|
| PubChem CID | 69417615 |
| Molecular Formula | C33H38N6O2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | [2,2-dimethyl-1-[3-[2-[[4-[(2S)-7-phenyl-1,2,3,4-tetrahydro-1,6-naphthyridin-2-yl]pyrimidin-2-yl]amino]propyl]phenyl]propyl] carbamate |
| SMILES | CC(Cc1cccc(C(OC(N)=O)C(C)(C)C)c1)Nc1nccc([C@@H]2CCc3cnc(-c4ccccc4)cc3N2)n1 |
| InChI | InChI=1S/C33H38N6O2/c1-21(17-22-9-8-12-24(18-22)30(33(2,3)4)41-31(34)40)37-32-35-16-15-27(39-32)26-14-13-25-20-36-28(19-29(25)38-26)23-10-6-5-7-11-23/h5-12,15-16,18-21,26,30,38H,13-14,17H2,1-4H3,(H2,34,40)(H,35,37,39)/t21?,26-,30?/m0/s1 |
| InChIKey | LJWBNTULAMFHMV-GGZQPEMISA-N |
| XLogP | 6.86 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |