C22H29NO2 — CID 69418143
2-methyl-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydro-5H-1,3-benzoxazol-4-ol (PubChem CID 69418143) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-methyl-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydro-5H-1,3-benzoxazol-4-ol.
| Compound Name | 2-methyl-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydro-5H-1,3-benzoxazol-4-ol |
|---|---|
| PubChem CID | 69418143 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 2-methyl-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydro-5H-1,3-benzoxazol-4-ol |
| SMILES | Cc1nc2c(o1)CCCC2(O)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C22H29NO2/c1-14-23-19-18(25-14)7-6-10-22(19,24)15-8-9-16-17(13-15)21(4,5)12-11-20(16,2)3/h8-9,13,24H,6-7,10-12H2,1-5H3 |
| InChIKey | LSQHVXLDBZGBEF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |