About (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride
(3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride (PubChem CID 69418164) has the molecular formula C8H17Cl2NO
and a molecular weight of 214.14 g/mol. Its IUPAC name is (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride.
Molecular Properties
| Compound Name | (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride |
| PubChem CID | 69418164 |
| Molecular Formula | C8H17Cl2NO |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride |
| SMILES | C[C@H]1COC[C@H](C)N1CCCl.Cl |
| InChI | InChI=1S/C8H16ClNO.ClH/c1-7-5-11-6-8(2)10(7)4-3-9;/h7-8H,3-6H2,1-2H3;1H/t7-,8-;/m0./s1 |
| InChIKey | WWYOWRITJYFWIF-WSZWBAFRSA-N |
| XLogP | 1.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride?
The IUPAC name of (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride (CID 69418164) is (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride.
What is the SMILES notation for (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride?
The canonical SMILES for (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride is C[C@H]1COC[C@H](C)N1CCCl.Cl.
What is the InChIKey of (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride?
The InChIKey is WWYOWRITJYFWIF-WSZWBAFRSA-N. The full InChI is InChI=1S/C8H16ClNO.ClH/c1-7-5-11-6-8(2)10(7)4-3-9;/h7-8H,3-6H2,1-2H3;1H/t7-,8-;/m0./s1.
What are the key properties of (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride?
(3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride has a molecular weight of 214.14 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-4-(2-chloroethyl)-3,5-dimethylmorpholine;hydrochloride is sourced from PubChem (CID 69418164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).