C33H32N6O — CID 69418423
3-[1-[[4-(6-amino-2-phenyl-2H-quinazolin-3-yl)phenyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 69418423) has the molecular formula C33H32N6O and a molecular weight of 528.66 g/mol. Its IUPAC name is 3-[1-[[4-(6-amino-2-phenyl-2H-quinazolin-3-yl)phenyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[[4-(6-amino-2-phenyl-2H-quinazolin-3-yl)phenyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 69418423 |
| Molecular Formula | C33H32N6O |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 3-[1-[[4-(6-amino-2-phenyl-2H-quinazolin-3-yl)phenyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | Nc1ccc2c(c1)=CN(c1ccc(CN3CCC(n4c(=O)[nH]c5ccccc54)CC3)cc1)C(c1ccccc1)N=2 |
| InChI | InChI=1S/C33H32N6O/c34-26-12-15-29-25(20-26)22-38(32(35-29)24-6-2-1-3-7-24)27-13-10-23(11-14-27)21-37-18-16-28(17-19-37)39-31-9-5-4-8-30(31)36-33(39)40/h1-15,20,22,28,32H,16-19,21,34H2,(H,36,40) |
| InChIKey | BZOANRLYSLDGCQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 82.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|