About (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride
(1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride (PubChem CID 69418771) has the molecular formula C9H17Cl2NO
and a molecular weight of 226.15 g/mol. Its IUPAC name is (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride.
Molecular Properties
| Compound Name | (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride |
| PubChem CID | 69418771 |
| Molecular Formula | C9H17Cl2NO |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride |
| SMILES | CC1(C)O[C@@H]2C[C@@H]1N(CCCl)C2.Cl |
| InChI | InChI=1S/C9H16ClNO.ClH/c1-9(2)8-5-7(12-9)6-11(8)4-3-10;/h7-8H,3-6H2,1-2H3;1H/t7-,8+;/m1./s1 |
| InChIKey | RQTRNSPKHAOTAI-WLYNEOFISA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride?
The IUPAC name of (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride (CID 69418771) is (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride.
What is the SMILES notation for (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride?
The canonical SMILES for (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride is CC1(C)O[C@@H]2C[C@@H]1N(CCCl)C2.Cl.
What is the InChIKey of (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride?
The InChIKey is RQTRNSPKHAOTAI-WLYNEOFISA-N. The full InChI is InChI=1S/C9H16ClNO.ClH/c1-9(2)8-5-7(12-9)6-11(8)4-3-10;/h7-8H,3-6H2,1-2H3;1H/t7-,8+;/m1./s1.
What are the key properties of (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride?
(1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride has a molecular weight of 226.15 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4S)-5-(2-chloroethyl)-3,3-dimethyl-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride is sourced from PubChem (CID 69418771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).