C23H30O2 — CID 69418838
4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydro-5H-1-benzofuran-4-ol (PubChem CID 69418838) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydro-5H-1-benzofuran-4-ol.
| Compound Name | 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydro-5H-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 69418838 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-6,7-dihydro-5H-1-benzofuran-4-ol |
| SMILES | Cc1cc2c(cc1C1(O)CCCc3occc31)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H30O2/c1-15-13-18-19(22(4,5)11-10-21(18,2)3)14-17(15)23(24)9-6-7-20-16(23)8-12-25-20/h8,12-14,24H,6-7,9-11H2,1-5H3 |
| InChIKey | SFVYGAKWWSTMGJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |