About (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide
(2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide (PubChem CID 69419761) has the molecular formula C11H12F3NO2S
and a molecular weight of 279.28 g/mol. Its IUPAC name is (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide.
Molecular Properties
| Compound Name | (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide |
| PubChem CID | 69419761 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide |
| SMILES | CCC1CO[S@@](=O)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H12F3NO2S/c1-2-9-7-17-18(16)15(9)10-5-3-8(4-6-10)11(12,13)14/h3-6,9H,2,7H2,1H3/t9?,18-/m1/s1 |
| InChIKey | AKKIGRMWDLLSMB-ROGCICSOSA-N |
| XLogP | 2.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide?
The IUPAC name of (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide (CID 69419761) is (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide.
What is the SMILES notation for (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide?
The canonical SMILES for (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide is CCC1CO[S@@](=O)N1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide?
The InChIKey is AKKIGRMWDLLSMB-ROGCICSOSA-N. The full InChI is InChI=1S/C11H12F3NO2S/c1-2-9-7-17-18(16)15(9)10-5-3-8(4-6-10)11(12,13)14/h3-6,9H,2,7H2,1H3/t9?,18-/m1/s1.
What are the key properties of (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide?
(2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide has a molecular weight of 279.28 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-ethyl-3-[4-(trifluoromethyl)phenyl]oxathiazolidine 2-oxide is sourced from PubChem (CID 69419761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).