About 2-aminobenzamide
2-aminobenzamide (PubChem CID 6942) has the molecular formula C7H8N2O
and a molecular weight of 136.15 g/mol. Its IUPAC name is 2-aminobenzamide.
Molecular Properties
| Compound Name | 2-aminobenzamide |
| PubChem CID | 6942 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 2-aminobenzamide |
| SMILES | NC(=O)c1ccccc1N |
| InChI | InChI=1S/C7H8N2O/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,8H2,(H2,9,10) |
| InChIKey | PXBFMLJZNCDSMP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzamide?
The IUPAC name of 2-aminobenzamide (CID 6942) is 2-aminobenzamide.
What is the SMILES notation for 2-aminobenzamide?
The canonical SMILES for 2-aminobenzamide is NC(=O)c1ccccc1N.
What is the InChIKey of 2-aminobenzamide?
The InChIKey is PXBFMLJZNCDSMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,8H2,(H2,9,10).
What are the key properties of 2-aminobenzamide?
2-aminobenzamide has a molecular weight of 136.15 g/mol, XLogP of 0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzamide is sourced from PubChem (CID 6942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).