C36H45N5O7 — CID 69420329
N-[(2S,4S,5S)-5-[[2-(2,6-dimethyl-4-nitrophenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-4-(2-oxoimidazolidin-1-yl)butanamide (PubChem CID 69420329) has the molecular formula C36H45N5O7 and a molecular weight of 659.78 g/mol. Its IUPAC name is N-[(2S,4S,5S)-5-[[2-(2,6-dimethyl-4-nitrophenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-4-(2-oxoimidazolidin-1-yl)butanamide.
| Compound Name | N-[(2S,4S,5S)-5-[[2-(2,6-dimethyl-4-nitrophenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-4-(2-oxoimidazolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 69420329 |
| Molecular Formula | C36H45N5O7 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.33 |
| IUPAC Name | N-[(2S,4S,5S)-5-[[2-(2,6-dimethyl-4-nitrophenoxy)acetyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methyl-4-(2-oxoimidazolidin-1-yl)butanamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)CC(C)CN1CCNC1=O |
| InChI | InChI=1S/C36H45N5O7/c1-24(22-40-15-14-37-36(40)45)16-33(43)38-29(19-27-10-6-4-7-11-27)21-32(42)31(20-28-12-8-5-9-13-28)39-34(44)23-48-35-25(2)17-30(41(46)47)18-26(35)3/h4-13,17-18,24,29,31-32,42H,14-16,19-23H2,1-3H3,(H,37,45)(H,38,43)(H,39,44)/t24?,29-,31-,32-/m0/s1 |
| InChIKey | MQWHKWMFNJYPSL-SFSZKHGUSA-N |
| XLogP | 3.85 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|